C26H22N4O5S2 — CID 5033170
N-[5-[ethyl(phenyl)sulfamoyl]-2-methoxyphenyl]-2-oxo-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide (PubChem CID 5033170) has the molecular formula C26H22N4O5S2 and a molecular weight of 534.62 g/mol. Its IUPAC name is N-[5-[ethyl(phenyl)sulfamoyl]-2-methoxyphenyl]-2-oxo-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide.
| Compound Name | N-[5-[ethyl(phenyl)sulfamoyl]-2-methoxyphenyl]-2-oxo-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide |
|---|---|
| PubChem CID | 5033170 |
| Molecular Formula | C26H22N4O5S2 |
| Molecular Weight | 534.62 g/mol |
| Exact Mass | 534.10 |
| IUPAC Name | N-[5-[ethyl(phenyl)sulfamoyl]-2-methoxyphenyl]-2-oxo-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(OC)c(NC(=O)c2cc3c(=O)n4ccccc4nc3s2)c1 |
| InChI | InChI=1S/C26H22N4O5S2/c1-3-30(17-9-5-4-6-10-17)37(33,34)18-12-13-21(35-2)20(15-18)27-24(31)22-16-19-25(36-22)28-23-11-7-8-14-29(23)26(19)32/h4-16H,3H2,1-2H3,(H,27,31) |
| InChIKey | PCBQHLMOSKDSCV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.62 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |