C22H29N3O4S — CID 4553215
1-cyclohexyl-3-[5-[ethyl(phenyl)sulfamoyl]-2-methoxyphenyl]urea (PubChem CID 4553215) has the molecular formula C22H29N3O4S and a molecular weight of 431.56 g/mol. Its IUPAC name is 1-cyclohexyl-3-[5-[ethyl(phenyl)sulfamoyl]-2-methoxyphenyl]urea.
| Compound Name | 1-cyclohexyl-3-[5-[ethyl(phenyl)sulfamoyl]-2-methoxyphenyl]urea |
|---|---|
| PubChem CID | 4553215 |
| Molecular Formula | C22H29N3O4S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 1-cyclohexyl-3-[5-[ethyl(phenyl)sulfamoyl]-2-methoxyphenyl]urea |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(OC)c(NC(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C22H29N3O4S/c1-3-25(18-12-8-5-9-13-18)30(27,28)19-14-15-21(29-2)20(16-19)24-22(26)23-17-10-6-4-7-11-17/h5,8-9,12-17H,3-4,6-7,10-11H2,1-2H3,(H2,23,24,26) |
| InChIKey | BLIDOFBKAHQUTQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |