C24H21N5O2S — CID 1297140
1-(2-methoxy-5-methylphenyl)-3-[(2-pyridin-2-ylquinoline-4-carbonyl)amino]thiourea (PubChem CID 1297140) has the molecular formula C24H21N5O2S and a molecular weight of 443.53 g/mol. Its IUPAC name is 1-(2-methoxy-5-methylphenyl)-3-[(2-pyridin-2-ylquinoline-4-carbonyl)amino]thiourea.
| Compound Name | 1-(2-methoxy-5-methylphenyl)-3-[(2-pyridin-2-ylquinoline-4-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 1297140 |
| Molecular Formula | C24H21N5O2S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 1-(2-methoxy-5-methylphenyl)-3-[(2-pyridin-2-ylquinoline-4-carbonyl)amino]thiourea |
| SMILES | COc1ccc(C)cc1NC(=S)NNC(=O)c1cc(-c2ccccn2)nc2ccccc12 |
| InChI | InChI=1S/C24H21N5O2S/c1-15-10-11-22(31-2)21(13-15)27-24(32)29-28-23(30)17-14-20(19-9-5-6-12-25-19)26-18-8-4-3-7-16(17)18/h3-14H,1-2H3,(H,28,30)(H2,27,29,32) |
| InChIKey | HQWOSAWKGCPHDN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|