C25H20N4O2 — CID 26775351
N'-[(E)-3-(3-methylphenyl)prop-2-enoyl]-2-pyridin-2-ylquinoline-4-carbohydrazide (PubChem CID 26775351) has the molecular formula C25H20N4O2 and a molecular weight of 408.46 g/mol. Its IUPAC name is N'-[(E)-3-(3-methylphenyl)prop-2-enoyl]-2-pyridin-2-ylquinoline-4-carbohydrazide.
| Compound Name | N'-[(E)-3-(3-methylphenyl)prop-2-enoyl]-2-pyridin-2-ylquinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 26775351 |
| Molecular Formula | C25H20N4O2 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | N'-[(E)-3-(3-methylphenyl)prop-2-enoyl]-2-pyridin-2-ylquinoline-4-carbohydrazide |
| SMILES | Cc1cccc(/C=C/C(=O)NNC(=O)c2cc(-c3ccccn3)nc3ccccc23)c1 |
| InChI | InChI=1S/C25H20N4O2/c1-17-7-6-8-18(15-17)12-13-24(30)28-29-25(31)20-16-23(22-11-4-5-14-26-22)27-21-10-3-2-9-19(20)21/h2-16H,1H3,(H,28,30)(H,29,31)/b13-12+ |
| InChIKey | LJMYOVAFWKELGP-OUKQBFOZSA-N |
| XLogP | 4.08 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|