C17H17N5O3 — CID 31638385
N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-5-methyl-2-phenyltriazole-4-carboxamide (PubChem CID 31638385) has the molecular formula C17H17N5O3 and a molecular weight of 339.35 g/mol. Its IUPAC name is N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-5-methyl-2-phenyltriazole-4-carboxamide.
| Compound Name | N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-5-methyl-2-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 31638385 |
| Molecular Formula | C17H17N5O3 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-5-methyl-2-phenyltriazole-4-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)nc1C(=O)NCC(=O)NCc1ccco1 |
| InChI | InChI=1S/C17H17N5O3/c1-12-16(21-22(20-12)13-6-3-2-4-7-13)17(24)19-11-15(23)18-10-14-8-5-9-25-14/h2-9H,10-11H2,1H3,(H,18,23)(H,19,24) |
| InChIKey | JJLXAMWSBIZJHV-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 102.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |