C6H10N2S — CID 3164022
4-ethyl-5-methyl-1,3-thiazol-2-amine (PubChem CID 3164022) has the molecular formula C6H10N2S and a molecular weight of 142.23 g/mol. Its IUPAC name is 4-ethyl-5-methyl-1,3-thiazol-2-amine.
| Compound Name | 4-ethyl-5-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 3164022 |
| Molecular Formula | C6H10N2S |
| Molecular Weight | 142.23 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | 4-ethyl-5-methyl-1,3-thiazol-2-amine |
| SMILES | CCc1nc(N)sc1C |
| InChI | InChI=1S/C6H10N2S/c1-3-5-4(2)9-6(7)8-5/h3H2,1-2H3,(H2,7,8) |
| InChIKey | XPDXICVHAINXCZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.23 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |