C10H18N2S — CID 23585837
4-butyl-5-propyl-1,3-thiazol-2-amine (PubChem CID 23585837) has the molecular formula C10H18N2S and a molecular weight of 198.33 g/mol. Its IUPAC name is 4-butyl-5-propyl-1,3-thiazol-2-amine.
| Compound Name | 4-butyl-5-propyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 23585837 |
| Molecular Formula | C10H18N2S |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 4-butyl-5-propyl-1,3-thiazol-2-amine |
| SMILES | CCCCc1nc(N)sc1CCC |
| InChI | InChI=1S/C10H18N2S/c1-3-5-7-8-9(6-4-2)13-10(11)12-8/h3-7H2,1-2H3,(H2,11,12) |
| InChIKey | ZNFBTPMYWAYKSL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |