C23H26N6O3S — CID 3164715
2-[4-methyl-5-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]-N-phenylacetamide (PubChem CID 3164715) has the molecular formula C23H26N6O3S and a molecular weight of 466.57 g/mol. Its IUPAC name is 2-[4-methyl-5-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]-N-phenylacetamide.
| Compound Name | 2-[4-methyl-5-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 3164715 |
| Molecular Formula | C23H26N6O3S |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 2-[4-methyl-5-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]-N-phenylacetamide |
| SMILES | Cn1c(CC(=O)Nc2ccccc2)nnc1SCC(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C23H26N6O3S/c1-28-20(15-21(30)24-17-5-3-2-4-6-17)26-27-23(28)33-16-22(31)25-18-7-9-19(10-8-18)29-11-13-32-14-12-29/h2-10H,11-16H2,1H3,(H,24,30)(H,25,31) |
| InChIKey | UNEZGKLGPGKZPQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|