C24H27FN6O3S — CID 40990787
2-fluoro-N-[(1S)-1-[4-methyl-5-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]ethyl]benzamide (PubChem CID 40990787) has the molecular formula C24H27FN6O3S and a molecular weight of 498.58 g/mol. Its IUPAC name is 2-fluoro-N-[(1S)-1-[4-methyl-5-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]ethyl]benzamide.
| Compound Name | 2-fluoro-N-[(1S)-1-[4-methyl-5-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 40990787 |
| Molecular Formula | C24H27FN6O3S |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | 2-fluoro-N-[(1S)-1-[4-methyl-5-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]ethyl]benzamide |
| SMILES | C[C@H](NC(=O)c1ccccc1F)c1nnc(SCC(=O)Nc2ccc(N3CCOCC3)cc2)n1C |
| InChI | InChI=1S/C24H27FN6O3S/c1-16(26-23(33)19-5-3-4-6-20(19)25)22-28-29-24(30(22)2)35-15-21(32)27-17-7-9-18(10-8-17)31-11-13-34-14-12-31/h3-10,16H,11-15H2,1-2H3,(H,26,33)(H,27,32)/t16-/m0/s1 |
| InChIKey | PWHUCJGMOBMTJA-INIZCTEOSA-N |
| XLogP | 3.01 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|