C21H21FN6O4S — CID 4208611
2-fluoro-N-[1-[4-methyl-5-[2-(4-methyl-3-nitroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]ethyl]benzamide (PubChem CID 4208611) has the molecular formula C21H21FN6O4S and a molecular weight of 472.50 g/mol. Its IUPAC name is 2-fluoro-N-[1-[4-methyl-5-[2-(4-methyl-3-nitroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]ethyl]benzamide.
| Compound Name | 2-fluoro-N-[1-[4-methyl-5-[2-(4-methyl-3-nitroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 4208611 |
| Molecular Formula | C21H21FN6O4S |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 2-fluoro-N-[1-[4-methyl-5-[2-(4-methyl-3-nitroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]ethyl]benzamide |
| SMILES | Cc1ccc(NC(=O)CSc2nnc(C(C)NC(=O)c3ccccc3F)n2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H21FN6O4S/c1-12-8-9-14(10-17(12)28(31)32)24-18(29)11-33-21-26-25-19(27(21)3)13(2)23-20(30)15-6-4-5-7-16(15)22/h4-10,13H,11H2,1-3H3,(H,23,30)(H,24,29) |
| InChIKey | QHSYDSLVLPCSHO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 132.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|