C20H22N6O2S2 — CID 31650863
2-[[4-amino-5-[(3,5-dimethylphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanylmethyl]-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 31650863) has the molecular formula C20H22N6O2S2 and a molecular weight of 442.57 g/mol. Its IUPAC name is 2-[[4-amino-5-[(3,5-dimethylphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanylmethyl]-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[[4-amino-5-[(3,5-dimethylphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanylmethyl]-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 31650863 |
| Molecular Formula | C20H22N6O2S2 |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 2-[[4-amino-5-[(3,5-dimethylphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanylmethyl]-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1cc(C)cc(OCc2nnc(SCc3nc4sc(C)c(C)c4c(=O)[nH]3)n2N)c1 |
| InChI | InChI=1S/C20H22N6O2S2/c1-10-5-11(2)7-14(6-10)28-8-16-24-25-20(26(16)21)29-9-15-22-18(27)17-12(3)13(4)30-19(17)23-15/h5-7H,8-9,21H2,1-4H3,(H,22,23,27) |
| InChIKey | YRJFZYXZSWAXNA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |