C16H15Cl2NO4 — CID 3165150
5,6-dichloro-8-ethoxy-3-(pyrrolidine-1-carbonyl)chromen-2-one (PubChem CID 3165150) has the molecular formula C16H15Cl2NO4 and a molecular weight of 356.21 g/mol. Its IUPAC name is 5,6-dichloro-8-ethoxy-3-(pyrrolidine-1-carbonyl)chromen-2-one.
| Compound Name | 5,6-dichloro-8-ethoxy-3-(pyrrolidine-1-carbonyl)chromen-2-one |
|---|---|
| PubChem CID | 3165150 |
| Molecular Formula | C16H15Cl2NO4 |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 5,6-dichloro-8-ethoxy-3-(pyrrolidine-1-carbonyl)chromen-2-one |
| SMILES | CCOc1cc(Cl)c(Cl)c2cc(C(=O)N3CCCC3)c(=O)oc12 |
| InChI | InChI=1S/C16H15Cl2NO4/c1-2-22-12-8-11(17)13(18)9-7-10(16(21)23-14(9)12)15(20)19-5-3-4-6-19/h7-8H,2-6H2,1H3 |
| InChIKey | WKGWGTDEZOSUKH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|