C33H24ClN3O3S2 — CID 3165825
ethyl 2-[[3-amino-4-(4-chlorophenyl)-6-phenylthieno[2,3-b]pyridine-2-carbonyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 3165825) has the molecular formula C33H24ClN3O3S2 and a molecular weight of 610.16 g/mol. Its IUPAC name is ethyl 2-[[3-amino-4-(4-chlorophenyl)-6-phenylthieno[2,3-b]pyridine-2-carbonyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[3-amino-4-(4-chlorophenyl)-6-phenylthieno[2,3-b]pyridine-2-carbonyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 3165825 |
| Molecular Formula | C33H24ClN3O3S2 |
| Molecular Weight | 610.16 g/mol |
| Exact Mass | 609.09 |
| IUPAC Name | ethyl 2-[[3-amino-4-(4-chlorophenyl)-6-phenylthieno[2,3-b]pyridine-2-carbonyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)c1sc2nc(-c3ccccc3)cc(-c3ccc(Cl)cc3)c2c1N |
| InChI | InChI=1S/C33H24ClN3O3S2/c1-2-40-33(39)27-24(19-9-5-3-6-10-19)18-41-31(27)37-30(38)29-28(35)26-23(20-13-15-22(34)16-14-20)17-25(36-32(26)42-29)21-11-7-4-8-12-21/h3-18H,2,35H2,1H3,(H,37,38) |
| InChIKey | RWODXTLCRFFWPK-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.16 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|