C11H18O2 — CID 316619
2-Propanone, 1-(1-cyclohexen-1-yl)-3-ethoxy- (PubChem CID 316619) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-3-ethoxypropan-2-one.
| Compound Name | 2-Propanone, 1-(1-cyclohexen-1-yl)-3-ethoxy- |
|---|---|
| PubChem CID | 316619 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 1-(cyclohexen-1-yl)-3-ethoxypropan-2-one |
| SMILES | CCOCC(=O)CC1=CCCCC1 |
| InChI | InChI=1S/C11H18O2/c1-2-13-9-11(12)8-10-6-4-3-5-7-10/h6H,2-5,7-9H2,1H3 |
| InChIKey | DMBFWWMYLQDOSA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | 194 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|