C13H17N5O5S — CID 31667015
4-methoxy-N-[2-[(3-methyl-5-nitroimidazol-4-yl)amino]ethyl]benzenesulfonamide (PubChem CID 31667015) has the molecular formula C13H17N5O5S and a molecular weight of 355.38 g/mol. Its IUPAC name is 4-methoxy-N-[2-[(3-methyl-5-nitroimidazol-4-yl)amino]ethyl]benzenesulfonamide.
| Compound Name | 4-methoxy-N-[2-[(3-methyl-5-nitroimidazol-4-yl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 31667015 |
| Molecular Formula | C13H17N5O5S |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 4-methoxy-N-[2-[(3-methyl-5-nitroimidazol-4-yl)amino]ethyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCNc2c([N+](=O)[O-])ncn2C)cc1 |
| InChI | InChI=1S/C13H17N5O5S/c1-17-9-15-13(18(19)20)12(17)14-7-8-16-24(21,22)11-5-3-10(23-2)4-6-11/h3-6,9,14,16H,7-8H2,1-2H3 |
| InChIKey | XICBWVFFHCRYSP-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 128.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|