C16H15N3O3S2 — CID 31667279
4-[(2-methoxy-5-nitrophenyl)methylsulfanyl]-5,6-dimethylthieno[2,3-d]pyrimidine (PubChem CID 31667279) has the molecular formula C16H15N3O3S2 and a molecular weight of 361.45 g/mol. Its IUPAC name is 4-[(2-methoxy-5-nitrophenyl)methylsulfanyl]-5,6-dimethylthieno[2,3-d]pyrimidine.
| Compound Name | 4-[(2-methoxy-5-nitrophenyl)methylsulfanyl]-5,6-dimethylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 31667279 |
| Molecular Formula | C16H15N3O3S2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 4-[(2-methoxy-5-nitrophenyl)methylsulfanyl]-5,6-dimethylthieno[2,3-d]pyrimidine |
| SMILES | COc1ccc([N+](=O)[O-])cc1CSc1ncnc2sc(C)c(C)c12 |
| InChI | InChI=1S/C16H15N3O3S2/c1-9-10(2)24-16-14(9)15(17-8-18-16)23-7-11-6-12(19(20)21)4-5-13(11)22-3/h4-6,8H,7H2,1-3H3 |
| InChIKey | XFYNPMCQWJEFDU-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|