C15H17N5S — CID 3168769
2-[2-(4-methyl-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl)ethyl]-1H-benzimidazole (PubChem CID 3168769) has the molecular formula C15H17N5S and a molecular weight of 299.40 g/mol. Its IUPAC name is 2-[2-(4-methyl-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl)ethyl]-1H-benzimidazole.
| Compound Name | 2-[2-(4-methyl-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl)ethyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 3168769 |
| Molecular Formula | C15H17N5S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-[2-(4-methyl-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl)ethyl]-1H-benzimidazole |
| SMILES | C=CCSc1nnc(CCc2nc3ccccc3[nH]2)n1C |
| InChI | InChI=1S/C15H17N5S/c1-3-10-21-15-19-18-14(20(15)2)9-8-13-16-11-6-4-5-7-12(11)17-13/h3-7H,1,8-10H2,2H3,(H,16,17) |
| InChIKey | FWAGISVTDPHFDW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|