C22H14FN7O3S — CID 31700377
N'-[1-(3-fluorophenyl)-5-thiophen-2-yl-1,2,4-triazole-3-carbonyl]-4-oxo-3H-phthalazine-1-carbohydrazide (PubChem CID 31700377) has the molecular formula C22H14FN7O3S and a molecular weight of 475.47 g/mol. Its IUPAC name is N'-[1-(3-fluorophenyl)-5-thiophen-2-yl-1,2,4-triazole-3-carbonyl]-4-oxo-3H-phthalazine-1-carbohydrazide.
| Compound Name | N'-[1-(3-fluorophenyl)-5-thiophen-2-yl-1,2,4-triazole-3-carbonyl]-4-oxo-3H-phthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 31700377 |
| Molecular Formula | C22H14FN7O3S |
| Molecular Weight | 475.47 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | N'-[1-(3-fluorophenyl)-5-thiophen-2-yl-1,2,4-triazole-3-carbonyl]-4-oxo-3H-phthalazine-1-carbohydrazide |
| SMILES | O=C(NNC(=O)c1n[nH]c(=O)c2ccccc12)c1nc(-c2cccs2)n(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C22H14FN7O3S/c23-12-5-3-6-13(11-12)30-19(16-9-4-10-34-16)24-18(29-30)22(33)28-27-21(32)17-14-7-1-2-8-15(14)20(31)26-25-17/h1-11H,(H,26,31)(H,27,32)(H,28,33) |
| InChIKey | QJCQBMIOMWDVQK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|