C18H13FN6O2S — CID 78839548
1-(3-fluorophenyl)-N'-(1H-pyrrole-2-carbonyl)-5-thiophen-2-yl-1,2,4-triazole-3-carbohydrazide (PubChem CID 78839548) has the molecular formula C18H13FN6O2S and a molecular weight of 396.41 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N'-(1H-pyrrole-2-carbonyl)-5-thiophen-2-yl-1,2,4-triazole-3-carbohydrazide.
| Compound Name | 1-(3-fluorophenyl)-N'-(1H-pyrrole-2-carbonyl)-5-thiophen-2-yl-1,2,4-triazole-3-carbohydrazide |
|---|---|
| PubChem CID | 78839548 |
| Molecular Formula | C18H13FN6O2S |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 1-(3-fluorophenyl)-N'-(1H-pyrrole-2-carbonyl)-5-thiophen-2-yl-1,2,4-triazole-3-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccc[nH]1)c1nc(-c2cccs2)n(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C18H13FN6O2S/c19-11-4-1-5-12(10-11)25-16(14-7-3-9-28-14)21-15(24-25)18(27)23-22-17(26)13-6-2-8-20-13/h1-10,20H,(H,22,26)(H,23,27) |
| InChIKey | CCEHARRBBSQMDB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|