C22H29N3O4S — CID 31750999
[2-[[(1R,2R,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]pyridine-3-carboxylate (PubChem CID 31750999) has the molecular formula C22H29N3O4S and a molecular weight of 431.56 g/mol. Its IUPAC name is [2-[[(1R,2R,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]pyridine-3-carboxylate.
| Compound Name | [2-[[(1R,2R,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 31750999 |
| Molecular Formula | C22H29N3O4S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | [2-[[(1R,2R,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]pyridine-3-carboxylate |
| SMILES | Cc1noc(C)c1CSc1ncccc1C(=O)OCC(=O)N[C@@H]1CCC[C@H](C)[C@H]1C |
| InChI | InChI=1S/C22H29N3O4S/c1-13-7-5-9-19(14(13)2)24-20(26)11-28-22(27)17-8-6-10-23-21(17)30-12-18-15(3)25-29-16(18)4/h6,8,10,13-14,19H,5,7,9,11-12H2,1-4H3,(H,24,26)/t13-,14+,19+/m0/s1 |
| InChIKey | KAXQWTIQQMYECM-IQUTYRLHSA-N |
| XLogP | 4.08 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |