C23H30N6O — CID 3175118
3-[(1-cyclopentyltetrazol-5-yl)-(4-methylpiperidin-1-yl)methyl]-6-methyl-1H-quinolin-2-one (PubChem CID 3175118) has the molecular formula C23H30N6O and a molecular weight of 406.53 g/mol. Its IUPAC name is 3-[(1-cyclopentyltetrazol-5-yl)-(4-methylpiperidin-1-yl)methyl]-6-methyl-1H-quinolin-2-one.
| Compound Name | 3-[(1-cyclopentyltetrazol-5-yl)-(4-methylpiperidin-1-yl)methyl]-6-methyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 3175118 |
| Molecular Formula | C23H30N6O |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 3-[(1-cyclopentyltetrazol-5-yl)-(4-methylpiperidin-1-yl)methyl]-6-methyl-1H-quinolin-2-one |
| SMILES | Cc1ccc2[nH]c(=O)c(C(c3nnnn3C3CCCC3)N3CCC(C)CC3)cc2c1 |
| InChI | InChI=1S/C23H30N6O/c1-15-9-11-28(12-10-15)21(22-25-26-27-29(22)18-5-3-4-6-18)19-14-17-13-16(2)7-8-20(17)24-23(19)30/h7-8,13-15,18,21H,3-6,9-12H2,1-2H3,(H,24,30) |
| InChIKey | CQSBGWQJGGPHDT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |