C23H30N4O5S — CID 3175725
1-(2-morpholin-4-ylethyl)-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-3-(oxolan-2-ylmethyl)thiourea (PubChem CID 3175725) has the molecular formula C23H30N4O5S and a molecular weight of 474.58 g/mol. Its IUPAC name is 1-(2-morpholin-4-ylethyl)-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-3-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-(2-morpholin-4-ylethyl)-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-3-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3175725 |
| Molecular Formula | C23H30N4O5S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 1-(2-morpholin-4-ylethyl)-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-3-(oxolan-2-ylmethyl)thiourea |
| SMILES | O=c1[nH]c2cc3c(cc2cc1CN(CCN1CCOCC1)C(=S)NCC1CCCO1)OCO3 |
| InChI | InChI=1S/C23H30N4O5S/c28-22-17(10-16-11-20-21(32-15-31-20)12-19(16)25-22)14-27(4-3-26-5-8-29-9-6-26)23(33)24-13-18-2-1-7-30-18/h10-12,18H,1-9,13-15H2,(H,24,33)(H,25,28) |
| InChIKey | YONVDNNWVPJINQ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|