C20H15ClFN3O2S — CID 31761237
5-[(Z)-1-chloro-2-(4-prop-2-enoxyphenyl)ethenyl]-N-(4-fluorophenyl)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 31761237) has the molecular formula C20H15ClFN3O2S and a molecular weight of 415.88 g/mol. Its IUPAC name is 5-[(Z)-1-chloro-2-(4-prop-2-enoxyphenyl)ethenyl]-N-(4-fluorophenyl)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-[(Z)-1-chloro-2-(4-prop-2-enoxyphenyl)ethenyl]-N-(4-fluorophenyl)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 31761237 |
| Molecular Formula | C20H15ClFN3O2S |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | 5-[(Z)-1-chloro-2-(4-prop-2-enoxyphenyl)ethenyl]-N-(4-fluorophenyl)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | C=CCOc1ccc(/C=C(\Cl)c2nnc(C(=O)Nc3ccc(F)cc3)s2)cc1 |
| InChI | InChI=1S/C20H15ClFN3O2S/c1-2-11-27-16-9-3-13(4-10-16)12-17(21)19-24-25-20(28-19)18(26)23-15-7-5-14(22)6-8-15/h2-10,12H,1,11H2,(H,23,26)/b17-12- |
| InChIKey | YAVVEVQFQRYALC-ATVHPVEESA-N |
| XLogP | 5.23 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|