C19H22FN3O2 — CID 31773664
2-(3-acetamido-4-fluoroanilino)-N-[2-(2-methylphenyl)ethyl]acetamide (PubChem CID 31773664) has the molecular formula C19H22FN3O2 and a molecular weight of 343.40 g/mol. Its IUPAC name is 2-(3-acetamido-4-fluoroanilino)-N-[2-(2-methylphenyl)ethyl]acetamide.
| Compound Name | 2-(3-acetamido-4-fluoroanilino)-N-[2-(2-methylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 31773664 |
| Molecular Formula | C19H22FN3O2 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 2-(3-acetamido-4-fluoroanilino)-N-[2-(2-methylphenyl)ethyl]acetamide |
| SMILES | CC(=O)Nc1cc(NCC(=O)NCCc2ccccc2C)ccc1F |
| InChI | InChI=1S/C19H22FN3O2/c1-13-5-3-4-6-15(13)9-10-21-19(25)12-22-16-7-8-17(20)18(11-16)23-14(2)24/h3-8,11,22H,9-10,12H2,1-2H3,(H,21,25)(H,23,24) |
| InChIKey | LJHOXUFTJWWGRS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |