C28H26N6O3 — CID 3178171
2-[[2-(benzotriazol-1-yl)acetyl]-quinolin-3-ylamino]-N-cyclopentyl-2-(furan-2-yl)acetamide (PubChem CID 3178171) has the molecular formula C28H26N6O3 and a molecular weight of 494.56 g/mol. Its IUPAC name is 2-[[2-(benzotriazol-1-yl)acetyl]-quinolin-3-ylamino]-N-cyclopentyl-2-(furan-2-yl)acetamide.
| Compound Name | 2-[[2-(benzotriazol-1-yl)acetyl]-quinolin-3-ylamino]-N-cyclopentyl-2-(furan-2-yl)acetamide |
|---|---|
| PubChem CID | 3178171 |
| Molecular Formula | C28H26N6O3 |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | 2-[[2-(benzotriazol-1-yl)acetyl]-quinolin-3-ylamino]-N-cyclopentyl-2-(furan-2-yl)acetamide |
| SMILES | O=C(NC1CCCC1)C(c1ccco1)N(C(=O)Cn1nnc2ccccc21)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C28H26N6O3/c35-26(18-33-24-13-6-5-12-23(24)31-32-33)34(21-16-19-8-1-4-11-22(19)29-17-21)27(25-14-7-15-37-25)28(36)30-20-9-2-3-10-20/h1,4-8,11-17,20,27H,2-3,9-10,18H2,(H,30,36) |
| InChIKey | GKMVXPGLMSHXHP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 106.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |