C30H28N6O4 — CID 1152963
(2S)-2-[[2-(benzotriazol-1-yl)acetyl]-quinolin-3-ylamino]-N-cyclopentyl-2-(3,4-dihydroxyphenyl)acetamide (PubChem CID 1152963) has the molecular formula C30H28N6O4 and a molecular weight of 536.59 g/mol. Its IUPAC name is (2S)-2-[[2-(benzotriazol-1-yl)acetyl]-quinolin-3-ylamino]-N-cyclopentyl-2-(3,4-dihydroxyphenyl)acetamide.
| Compound Name | (2S)-2-[[2-(benzotriazol-1-yl)acetyl]-quinolin-3-ylamino]-N-cyclopentyl-2-(3,4-dihydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 1152963 |
| Molecular Formula | C30H28N6O4 |
| Molecular Weight | 536.59 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | (2S)-2-[[2-(benzotriazol-1-yl)acetyl]-quinolin-3-ylamino]-N-cyclopentyl-2-(3,4-dihydroxyphenyl)acetamide |
| SMILES | O=C(NC1CCCC1)[C@H](c1ccc(O)c(O)c1)N(C(=O)Cn1nnc2ccccc21)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C30H28N6O4/c37-26-14-13-20(16-27(26)38)29(30(40)32-21-8-2-3-9-21)36(22-15-19-7-1-4-10-23(19)31-17-22)28(39)18-35-25-12-6-5-11-24(25)33-34-35/h1,4-7,10-17,21,29,37-38H,2-3,8-9,18H2,(H,32,40)/t29-/m0/s1 |
| InChIKey | SDXHNQYAENTLER-LJAQVGFWSA-N |
| XLogP | 4.22 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.59 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|