C29H31N5O4 — CID 1153056
(2R)-2-(N-[2-(benzotriazol-1-yl)acetyl]-3,5-dimethylanilino)-N-cyclopentyl-2-(3,4-dihydroxyphenyl)acetamide (PubChem CID 1153056) has the molecular formula C29H31N5O4 and a molecular weight of 513.60 g/mol. Its IUPAC name is (2R)-2-(N-[2-(benzotriazol-1-yl)acetyl]-3,5-dimethylanilino)-N-cyclopentyl-2-(3,4-dihydroxyphenyl)acetamide.
| Compound Name | (2R)-2-(N-[2-(benzotriazol-1-yl)acetyl]-3,5-dimethylanilino)-N-cyclopentyl-2-(3,4-dihydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 1153056 |
| Molecular Formula | C29H31N5O4 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | (2R)-2-(N-[2-(benzotriazol-1-yl)acetyl]-3,5-dimethylanilino)-N-cyclopentyl-2-(3,4-dihydroxyphenyl)acetamide |
| SMILES | Cc1cc(C)cc(N(C(=O)Cn2nnc3ccccc32)[C@@H](C(=O)NC2CCCC2)c2ccc(O)c(O)c2)c1 |
| InChI | InChI=1S/C29H31N5O4/c1-18-13-19(2)15-22(14-18)34(27(37)17-33-24-10-6-5-9-23(24)31-32-33)28(20-11-12-25(35)26(36)16-20)29(38)30-21-7-3-4-8-21/h5-6,9-16,21,28,35-36H,3-4,7-8,17H2,1-2H3,(H,30,38)/t28-/m1/s1 |
| InChIKey | YCDCWNIEBAGVLH-MUUNZHRXSA-N |
| XLogP | 4.29 |
| TPSA | 120.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|