C32H36N6O6S — CID 98090376
(2R)-2-(N-[2-(benzotriazol-1-yl)acetyl]-4-piperidin-1-ylsulfonylanilino)-N-cyclopentyl-2-(3,4-dihydroxyphenyl)acetamide (PubChem CID 98090376) has the molecular formula C32H36N6O6S and a molecular weight of 632.74 g/mol. Its IUPAC name is (2R)-2-(N-[2-(benzotriazol-1-yl)acetyl]-4-piperidin-1-ylsulfonylanilino)-N-cyclopentyl-2-(3,4-dihydroxyphenyl)acetamide.
| Compound Name | (2R)-2-(N-[2-(benzotriazol-1-yl)acetyl]-4-piperidin-1-ylsulfonylanilino)-N-cyclopentyl-2-(3,4-dihydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 98090376 |
| Molecular Formula | C32H36N6O6S |
| Molecular Weight | 632.74 g/mol |
| Exact Mass | 632.24 |
| IUPAC Name | (2R)-2-(N-[2-(benzotriazol-1-yl)acetyl]-4-piperidin-1-ylsulfonylanilino)-N-cyclopentyl-2-(3,4-dihydroxyphenyl)acetamide |
| SMILES | O=C(NC1CCCC1)[C@@H](c1ccc(O)c(O)c1)N(C(=O)Cn1nnc2ccccc21)c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C32H36N6O6S/c39-28-17-12-22(20-29(28)40)31(32(42)33-23-8-2-3-9-23)38(30(41)21-37-27-11-5-4-10-26(27)34-35-37)24-13-15-25(16-14-24)45(43,44)36-18-6-1-7-19-36/h4-5,10-17,20,23,31,39-40H,1-3,6-9,18-19,21H2,(H,33,42)/t31-/m1/s1 |
| InChIKey | SHXZFVUWAJUJBE-WJOKGBTCSA-N |
| XLogP | 3.85 |
| TPSA | 157.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.74 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|