C28H35N5O4 — CID 1153079
(2R)-2-[[2-(benzotriazol-1-yl)acetyl]-cyclohexylamino]-N-cyclohexyl-2-(3,4-dihydroxyphenyl)acetamide (PubChem CID 1153079) has the molecular formula C28H35N5O4 and a molecular weight of 505.62 g/mol. Its IUPAC name is (2R)-2-[[2-(benzotriazol-1-yl)acetyl]-cyclohexylamino]-N-cyclohexyl-2-(3,4-dihydroxyphenyl)acetamide.
| Compound Name | (2R)-2-[[2-(benzotriazol-1-yl)acetyl]-cyclohexylamino]-N-cyclohexyl-2-(3,4-dihydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 1153079 |
| Molecular Formula | C28H35N5O4 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | (2R)-2-[[2-(benzotriazol-1-yl)acetyl]-cyclohexylamino]-N-cyclohexyl-2-(3,4-dihydroxyphenyl)acetamide |
| SMILES | O=C(NC1CCCCC1)[C@@H](c1ccc(O)c(O)c1)N(C(=O)Cn1nnc2ccccc21)C1CCCCC1 |
| InChI | InChI=1S/C28H35N5O4/c34-24-16-15-19(17-25(24)35)27(28(37)29-20-9-3-1-4-10-20)33(21-11-5-2-6-12-21)26(36)18-32-23-14-8-7-13-22(23)30-31-32/h7-8,13-17,20-21,27,34-35H,1-6,9-12,18H2,(H,29,37)/t27-/m1/s1 |
| InChIKey | AHPPDAWTVMEXJJ-HHHXNRCGSA-N |
| XLogP | 4.19 |
| TPSA | 120.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|