C28H29N5O5 — CID 3178314
2-(N-[2-(benzotriazol-1-yl)acetyl]-3-hydroxyanilino)-N-cyclohexyl-2-(3,4-dihydroxyphenyl)acetamide (PubChem CID 3178314) has the molecular formula C28H29N5O5 and a molecular weight of 515.57 g/mol. Its IUPAC name is 2-(N-[2-(benzotriazol-1-yl)acetyl]-3-hydroxyanilino)-N-cyclohexyl-2-(3,4-dihydroxyphenyl)acetamide.
| Compound Name | 2-(N-[2-(benzotriazol-1-yl)acetyl]-3-hydroxyanilino)-N-cyclohexyl-2-(3,4-dihydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 3178314 |
| Molecular Formula | C28H29N5O5 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | 2-(N-[2-(benzotriazol-1-yl)acetyl]-3-hydroxyanilino)-N-cyclohexyl-2-(3,4-dihydroxyphenyl)acetamide |
| SMILES | O=C(NC1CCCCC1)C(c1ccc(O)c(O)c1)N(C(=O)Cn1nnc2ccccc21)c1cccc(O)c1 |
| InChI | InChI=1S/C28H29N5O5/c34-21-10-6-9-20(16-21)33(26(37)17-32-23-12-5-4-11-22(23)30-31-32)27(18-13-14-24(35)25(36)15-18)28(38)29-19-7-2-1-3-8-19/h4-6,9-16,19,27,34-36H,1-3,7-8,17H2,(H,29,38) |
| InChIKey | YRCLDDHQJJGIBZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 140.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|