C20H20F2N4O2 — CID 31807297
2-(5,6-difluorobenzimidazol-1-yl)-1-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone (PubChem CID 31807297) has the molecular formula C20H20F2N4O2 and a molecular weight of 386.40 g/mol. Its IUPAC name is 2-(5,6-difluorobenzimidazol-1-yl)-1-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(5,6-difluorobenzimidazol-1-yl)-1-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 31807297 |
| Molecular Formula | C20H20F2N4O2 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 2-(5,6-difluorobenzimidazol-1-yl)-1-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone |
| SMILES | COc1ccc(N2CCN(C(=O)Cn3cnc4cc(F)c(F)cc43)CC2)cc1 |
| InChI | InChI=1S/C20H20F2N4O2/c1-28-15-4-2-14(3-5-15)24-6-8-25(9-7-24)20(27)12-26-13-23-18-10-16(21)17(22)11-19(18)26/h2-5,10-11,13H,6-9,12H2,1H3 |
| InChIKey | MWIBIHZVEBWRJF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|