C19H18FN5O2 — CID 31814622
1-(4-fluorophenyl)-5-methyl-N-[3-(methylcarbamoylamino)phenyl]pyrazole-4-carboxamide (PubChem CID 31814622) has the molecular formula C19H18FN5O2 and a molecular weight of 367.38 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-methyl-N-[3-(methylcarbamoylamino)phenyl]pyrazole-4-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-5-methyl-N-[3-(methylcarbamoylamino)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 31814622 |
| Molecular Formula | C19H18FN5O2 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 1-(4-fluorophenyl)-5-methyl-N-[3-(methylcarbamoylamino)phenyl]pyrazole-4-carboxamide |
| SMILES | CNC(=O)Nc1cccc(NC(=O)c2cnn(-c3ccc(F)cc3)c2C)c1 |
| InChI | InChI=1S/C19H18FN5O2/c1-12-17(11-22-25(12)16-8-6-13(20)7-9-16)18(26)23-14-4-3-5-15(10-14)24-19(27)21-2/h3-11H,1-2H3,(H,23,26)(H2,21,24,27) |
| InChIKey | ISAGWSSTMVYGBH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |