C20H17N3O2S2 — CID 31839493
2-(2-oxoquinoxalin-1-yl)-N,N-bis(thiophen-2-ylmethyl)acetamide (PubChem CID 31839493) has the molecular formula C20H17N3O2S2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 2-(2-oxoquinoxalin-1-yl)-N,N-bis(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-(2-oxoquinoxalin-1-yl)-N,N-bis(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 31839493 |
| Molecular Formula | C20H17N3O2S2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 2-(2-oxoquinoxalin-1-yl)-N,N-bis(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(Cn1c(=O)cnc2ccccc21)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C20H17N3O2S2/c24-19-11-21-17-7-1-2-8-18(17)23(19)14-20(25)22(12-15-5-3-9-26-15)13-16-6-4-10-27-16/h1-11H,12-14H2 |
| InChIKey | XHZUIXSNDZNXQW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |