C23H20N2O3S2 — CID 31841903
2-(4-pyridin-2-yloxyphenoxy)-N,N-bis(thiophen-2-ylmethyl)acetamide (PubChem CID 31841903) has the molecular formula C23H20N2O3S2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 2-(4-pyridin-2-yloxyphenoxy)-N,N-bis(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-(4-pyridin-2-yloxyphenoxy)-N,N-bis(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 31841903 |
| Molecular Formula | C23H20N2O3S2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 2-(4-pyridin-2-yloxyphenoxy)-N,N-bis(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(COc1ccc(Oc2ccccn2)cc1)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C23H20N2O3S2/c26-23(25(15-20-5-3-13-29-20)16-21-6-4-14-30-21)17-27-18-8-10-19(11-9-18)28-22-7-1-2-12-24-22/h1-14H,15-17H2 |
| InChIKey | CMGGIHJQHGTOMS-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |