C18H18N2O4S2 — CID 164739782
pyridin-2-yloxymethoxymethyl N,N-bis(thiophen-2-ylmethyl)carbamate (PubChem CID 164739782) has the molecular formula C18H18N2O4S2 and a molecular weight of 390.49 g/mol. Its IUPAC name is pyridin-2-yloxymethoxymethyl N,N-bis(thiophen-2-ylmethyl)carbamate.
| Compound Name | pyridin-2-yloxymethoxymethyl N,N-bis(thiophen-2-ylmethyl)carbamate |
|---|---|
| PubChem CID | 164739782 |
| Molecular Formula | C18H18N2O4S2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | pyridin-2-yloxymethoxymethyl N,N-bis(thiophen-2-ylmethyl)carbamate |
| SMILES | O=C(OCOCOc1ccccn1)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C18H18N2O4S2/c21-18(24-14-22-13-23-17-7-1-2-8-19-17)20(11-15-5-3-9-25-15)12-16-6-4-10-26-16/h1-10H,11-14H2 |
| InChIKey | MLEFPJQEOGIVLG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|