C29H27N3O6S4 — CID 164739552
[5-[bis(thiophen-2-ylmethyl)carbamoyloxymethoxy]-3-pyridinyl]oxymethyl N,N-bis(thiophen-2-ylmethyl)carbamate (PubChem CID 164739552) has the molecular formula C29H27N3O6S4 and a molecular weight of 641.82 g/mol. Its IUPAC name is [5-[bis(thiophen-2-ylmethyl)carbamoyloxymethoxy]-3-pyridinyl]oxymethyl N,N-bis(thiophen-2-ylmethyl)carbamate.
| Compound Name | [5-[bis(thiophen-2-ylmethyl)carbamoyloxymethoxy]-3-pyridinyl]oxymethyl N,N-bis(thiophen-2-ylmethyl)carbamate |
|---|---|
| PubChem CID | 164739552 |
| Molecular Formula | C29H27N3O6S4 |
| Molecular Weight | 641.82 g/mol |
| Exact Mass | 641.08 |
| IUPAC Name | [5-[bis(thiophen-2-ylmethyl)carbamoyloxymethoxy]-3-pyridinyl]oxymethyl N,N-bis(thiophen-2-ylmethyl)carbamate |
| SMILES | O=C(OCOc1cncc(OCOC(=O)N(Cc2cccs2)Cc2cccs2)c1)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C29H27N3O6S4/c33-28(31(16-24-5-1-9-39-24)17-25-6-2-10-40-25)37-20-35-22-13-23(15-30-14-22)36-21-38-29(34)32(18-26-7-3-11-41-26)19-27-8-4-12-42-27/h1-15H,16-21H2 |
| InChIKey | BRXYETDPDMZDIM-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 90.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.82 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|