C14H16N2O4S2 — CID 118113439
2-[bis(thiophen-2-ylmethyl)carbamoyloxy]ethylcarbamic acid (PubChem CID 118113439) has the molecular formula C14H16N2O4S2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 2-[bis(thiophen-2-ylmethyl)carbamoyloxy]ethylcarbamic acid.
| Compound Name | 2-[bis(thiophen-2-ylmethyl)carbamoyloxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 118113439 |
| Molecular Formula | C14H16N2O4S2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 2-[bis(thiophen-2-ylmethyl)carbamoyloxy]ethylcarbamic acid |
| SMILES | O=C(O)NCCOC(=O)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C14H16N2O4S2/c17-13(18)15-5-6-20-14(19)16(9-11-3-1-7-21-11)10-12-4-2-8-22-12/h1-4,7-8,15H,5-6,9-10H2,(H,17,18) |
| InChIKey | OWRGMUGVTJCEAB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|