C19H19F3N2O4S — CID 31843707
N-methoxy-N-methyl-3-[6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carbonyl]benzenesulfonamide (PubChem CID 31843707) has the molecular formula C19H19F3N2O4S and a molecular weight of 428.43 g/mol. Its IUPAC name is N-methoxy-N-methyl-3-[6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carbonyl]benzenesulfonamide.
| Compound Name | N-methoxy-N-methyl-3-[6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carbonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 31843707 |
| Molecular Formula | C19H19F3N2O4S |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | N-methoxy-N-methyl-3-[6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carbonyl]benzenesulfonamide |
| SMILES | CON(C)S(=O)(=O)c1cccc(C(=O)N2CCCc3cc(C(F)(F)F)ccc32)c1 |
| InChI | InChI=1S/C19H19F3N2O4S/c1-23(28-2)29(26,27)16-7-3-5-14(12-16)18(25)24-10-4-6-13-11-15(19(20,21)22)8-9-17(13)24/h3,5,7-9,11-12H,4,6,10H2,1-2H3 |
| InChIKey | FDCVPBPRAMMPJL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|