C19H21ClN2O6S2 — CID 55873945
2-chloro-N-methoxy-N-methyl-5-(6-methylsulfonyl-3,4-dihydro-2H-quinoline-1-carbonyl)benzenesulfonamide (PubChem CID 55873945) has the molecular formula C19H21ClN2O6S2 and a molecular weight of 472.97 g/mol. Its IUPAC name is 2-chloro-N-methoxy-N-methyl-5-(6-methylsulfonyl-3,4-dihydro-2H-quinoline-1-carbonyl)benzenesulfonamide.
| Compound Name | 2-chloro-N-methoxy-N-methyl-5-(6-methylsulfonyl-3,4-dihydro-2H-quinoline-1-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 55873945 |
| Molecular Formula | C19H21ClN2O6S2 |
| Molecular Weight | 472.97 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | 2-chloro-N-methoxy-N-methyl-5-(6-methylsulfonyl-3,4-dihydro-2H-quinoline-1-carbonyl)benzenesulfonamide |
| SMILES | CON(C)S(=O)(=O)c1cc(C(=O)N2CCCc3cc(S(C)(=O)=O)ccc32)ccc1Cl |
| InChI | InChI=1S/C19H21ClN2O6S2/c1-21(28-2)30(26,27)18-12-14(6-8-16(18)20)19(23)22-10-4-5-13-11-15(29(3,24)25)7-9-17(13)22/h6-9,11-12H,4-5,10H2,1-3H3 |
| InChIKey | DQGUJTLJLNZGDE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.97 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|