C21H22N4O2 — CID 31851493
N'-[2,5-dimethyl-1-[(1S)-1-phenylethyl]pyrrole-3-carbonyl]pyridine-2-carbohydrazide (PubChem CID 31851493) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is N'-[2,5-dimethyl-1-[(1S)-1-phenylethyl]pyrrole-3-carbonyl]pyridine-2-carbohydrazide.
| Compound Name | N'-[2,5-dimethyl-1-[(1S)-1-phenylethyl]pyrrole-3-carbonyl]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 31851493 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | N'-[2,5-dimethyl-1-[(1S)-1-phenylethyl]pyrrole-3-carbonyl]pyridine-2-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2ccccn2)c(C)n1[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C21H22N4O2/c1-14-13-18(16(3)25(14)15(2)17-9-5-4-6-10-17)20(26)23-24-21(27)19-11-7-8-12-22-19/h4-13,15H,1-3H3,(H,23,26)(H,24,27)/t15-/m0/s1 |
| InChIKey | WUTDFCRMAUQEFS-HNNXBMFYSA-N |
| XLogP | 3.18 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|