C21H18FN3O4S — CID 31855089
N-[4-(2-amino-2-oxoethyl)phenyl]-3-[(2-fluorophenyl)sulfamoyl]benzamide (PubChem CID 31855089) has the molecular formula C21H18FN3O4S and a molecular weight of 427.46 g/mol. Its IUPAC name is N-[4-(2-amino-2-oxoethyl)phenyl]-3-[(2-fluorophenyl)sulfamoyl]benzamide.
| Compound Name | N-[4-(2-amino-2-oxoethyl)phenyl]-3-[(2-fluorophenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 31855089 |
| Molecular Formula | C21H18FN3O4S |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | N-[4-(2-amino-2-oxoethyl)phenyl]-3-[(2-fluorophenyl)sulfamoyl]benzamide |
| SMILES | NC(=O)Cc1ccc(NC(=O)c2cccc(S(=O)(=O)Nc3ccccc3F)c2)cc1 |
| InChI | InChI=1S/C21H18FN3O4S/c22-18-6-1-2-7-19(18)25-30(28,29)17-5-3-4-15(13-17)21(27)24-16-10-8-14(9-11-16)12-20(23)26/h1-11,13,25H,12H2,(H2,23,26)(H,24,27) |
| InChIKey | DEOVODYTSKQLJE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |