C20H17FN2O4S — CID 55408815
3-[(2-fluorophenyl)sulfamoyl]-N-phenylmethoxybenzamide (PubChem CID 55408815) has the molecular formula C20H17FN2O4S and a molecular weight of 400.43 g/mol. Its IUPAC name is 3-[(2-fluorophenyl)sulfamoyl]-N-phenylmethoxybenzamide.
| Compound Name | 3-[(2-fluorophenyl)sulfamoyl]-N-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 55408815 |
| Molecular Formula | C20H17FN2O4S |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 3-[(2-fluorophenyl)sulfamoyl]-N-phenylmethoxybenzamide |
| SMILES | O=C(NOCc1ccccc1)c1cccc(S(=O)(=O)Nc2ccccc2F)c1 |
| InChI | InChI=1S/C20H17FN2O4S/c21-18-11-4-5-12-19(18)23-28(25,26)17-10-6-9-16(13-17)20(24)22-27-14-15-7-2-1-3-8-15/h1-13,23H,14H2,(H,22,24) |
| InChIKey | XGDLDLOHSXKPMT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|