C15H15N3O3 — CID 31861747
N-[4-(2-amino-2-oxoethyl)phenyl]-1-methyl-2-oxopyridine-4-carboxamide (PubChem CID 31861747) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is N-[4-(2-amino-2-oxoethyl)phenyl]-1-methyl-2-oxopyridine-4-carboxamide.
| Compound Name | N-[4-(2-amino-2-oxoethyl)phenyl]-1-methyl-2-oxopyridine-4-carboxamide |
|---|---|
| PubChem CID | 31861747 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | N-[4-(2-amino-2-oxoethyl)phenyl]-1-methyl-2-oxopyridine-4-carboxamide |
| SMILES | Cn1ccc(C(=O)Nc2ccc(CC(N)=O)cc2)cc1=O |
| InChI | InChI=1S/C15H15N3O3/c1-18-7-6-11(9-14(18)20)15(21)17-12-4-2-10(3-5-12)8-13(16)19/h2-7,9H,8H2,1H3,(H2,16,19)(H,17,21) |
| InChIKey | CRLVUUMNJOAEJQ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |