C17H14BrN3O2 — CID 31861888
N-[4-(2-amino-2-oxoethyl)phenyl]-6-bromo-1H-indole-2-carboxamide (PubChem CID 31861888) has the molecular formula C17H14BrN3O2 and a molecular weight of 372.22 g/mol. Its IUPAC name is N-[4-(2-amino-2-oxoethyl)phenyl]-6-bromo-1H-indole-2-carboxamide.
| Compound Name | N-[4-(2-amino-2-oxoethyl)phenyl]-6-bromo-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 31861888 |
| Molecular Formula | C17H14BrN3O2 |
| Molecular Weight | 372.22 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | N-[4-(2-amino-2-oxoethyl)phenyl]-6-bromo-1H-indole-2-carboxamide |
| SMILES | NC(=O)Cc1ccc(NC(=O)c2cc3ccc(Br)cc3[nH]2)cc1 |
| InChI | InChI=1S/C17H14BrN3O2/c18-12-4-3-11-8-15(21-14(11)9-12)17(23)20-13-5-1-10(2-6-13)7-16(19)22/h1-6,8-9,21H,7H2,(H2,19,22)(H,20,23) |
| InChIKey | RNFDGJNNWNIZGU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.22 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |