C15H22N6O — CID 3188668
N-butan-2-yl-2-[5-[4-(dimethylamino)phenyl]tetrazol-2-yl]acetamide (PubChem CID 3188668) has the molecular formula C15H22N6O and a molecular weight of 302.38 g/mol. Its IUPAC name is N-butan-2-yl-2-[5-[4-(dimethylamino)phenyl]tetrazol-2-yl]acetamide.
| Compound Name | N-butan-2-yl-2-[5-[4-(dimethylamino)phenyl]tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 3188668 |
| Molecular Formula | C15H22N6O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | N-butan-2-yl-2-[5-[4-(dimethylamino)phenyl]tetrazol-2-yl]acetamide |
| SMILES | CCC(C)NC(=O)Cn1nnc(-c2ccc(N(C)C)cc2)n1 |
| InChI | InChI=1S/C15H22N6O/c1-5-11(2)16-14(22)10-21-18-15(17-19-21)12-6-8-13(9-7-12)20(3)4/h6-9,11H,5,10H2,1-4H3,(H,16,22) |
| InChIKey | ZYSAHWMFRSTHAV-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |