C14H17FN6O2 — CID 7713348
N-[[(2R)-butan-2-yl]carbamoyl]-2-[5-(4-fluorophenyl)tetrazol-2-yl]acetamide (PubChem CID 7713348) has the molecular formula C14H17FN6O2 and a molecular weight of 320.33 g/mol. Its IUPAC name is N-[[(2R)-butan-2-yl]carbamoyl]-2-[5-(4-fluorophenyl)tetrazol-2-yl]acetamide.
| Compound Name | N-[[(2R)-butan-2-yl]carbamoyl]-2-[5-(4-fluorophenyl)tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 7713348 |
| Molecular Formula | C14H17FN6O2 |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | N-[[(2R)-butan-2-yl]carbamoyl]-2-[5-(4-fluorophenyl)tetrazol-2-yl]acetamide |
| SMILES | CC[C@@H](C)NC(=O)NC(=O)Cn1nnc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C14H17FN6O2/c1-3-9(2)16-14(23)17-12(22)8-21-19-13(18-20-21)10-4-6-11(15)7-5-10/h4-7,9H,3,8H2,1-2H3,(H2,16,17,22,23)/t9-/m1/s1 |
| InChIKey | VBQJOZXERUCYKO-SECBINFHSA-N |
| XLogP | 1.10 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |