C17H23N3O2 — CID 31887404
2-[(1S)-cyclopent-2-en-1-yl]-N-[3-(propan-2-ylcarbamoylamino)phenyl]acetamide (PubChem CID 31887404) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-[(1S)-cyclopent-2-en-1-yl]-N-[3-(propan-2-ylcarbamoylamino)phenyl]acetamide.
| Compound Name | 2-[(1S)-cyclopent-2-en-1-yl]-N-[3-(propan-2-ylcarbamoylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 31887404 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 2-[(1S)-cyclopent-2-en-1-yl]-N-[3-(propan-2-ylcarbamoylamino)phenyl]acetamide |
| SMILES | CC(C)NC(=O)Nc1cccc(NC(=O)C[C@H]2C=CCC2)c1 |
| InChI | InChI=1S/C17H23N3O2/c1-12(2)18-17(22)20-15-9-5-8-14(11-15)19-16(21)10-13-6-3-4-7-13/h3,5-6,8-9,11-13H,4,7,10H2,1-2H3,(H,19,21)(H2,18,20,22)/t13-/m0/s1 |
| InChIKey | GJWDEBHIFQKJBN-ZDUSSCGKSA-N |
| XLogP | 3.51 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|