C17H21ClN2O2 — CID 94141178
4-chloro-3-[[2-[(1R)-cyclopent-2-en-1-yl]acetyl]amino]-N-propan-2-ylbenzamide (PubChem CID 94141178) has the molecular formula C17H21ClN2O2 and a molecular weight of 320.82 g/mol. Its IUPAC name is 4-chloro-3-[[2-[(1R)-cyclopent-2-en-1-yl]acetyl]amino]-N-propan-2-ylbenzamide.
| Compound Name | 4-chloro-3-[[2-[(1R)-cyclopent-2-en-1-yl]acetyl]amino]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 94141178 |
| Molecular Formula | C17H21ClN2O2 |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 4-chloro-3-[[2-[(1R)-cyclopent-2-en-1-yl]acetyl]amino]-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1ccc(Cl)c(NC(=O)C[C@@H]2C=CCC2)c1 |
| InChI | InChI=1S/C17H21ClN2O2/c1-11(2)19-17(22)13-7-8-14(18)15(10-13)20-16(21)9-12-5-3-4-6-12/h3,5,7-8,10-12H,4,6,9H2,1-2H3,(H,19,22)(H,20,21)/t12-/m1/s1 |
| InChIKey | AVBLKJSTJLCQIJ-GFCCVEGCSA-N |
| XLogP | 3.77 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|