C25H23FN4O3S — CID 31892941
5-ethyl-1-(4-fluorophenyl)-N-[3-[methyl(phenyl)sulfamoyl]phenyl]pyrazole-4-carboxamide (PubChem CID 31892941) has the molecular formula C25H23FN4O3S and a molecular weight of 478.55 g/mol. Its IUPAC name is 5-ethyl-1-(4-fluorophenyl)-N-[3-[methyl(phenyl)sulfamoyl]phenyl]pyrazole-4-carboxamide.
| Compound Name | 5-ethyl-1-(4-fluorophenyl)-N-[3-[methyl(phenyl)sulfamoyl]phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 31892941 |
| Molecular Formula | C25H23FN4O3S |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 5-ethyl-1-(4-fluorophenyl)-N-[3-[methyl(phenyl)sulfamoyl]phenyl]pyrazole-4-carboxamide |
| SMILES | CCc1c(C(=O)Nc2cccc(S(=O)(=O)N(C)c3ccccc3)c2)cnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C25H23FN4O3S/c1-3-24-23(17-27-30(24)21-14-12-18(26)13-15-21)25(31)28-19-8-7-11-22(16-19)34(32,33)29(2)20-9-5-4-6-10-20/h4-17H,3H2,1-2H3,(H,28,31) |
| InChIKey | QMHDYJUEYKOOAE-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |