C28H30N4O6S — CID 3189532
N-cyclohex-2-en-1-yl-2-(3,4-dihydroxyphenyl)-2-(N-[2-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]sulfanylacetyl]anilino)acetamide (PubChem CID 3189532) has the molecular formula C28H30N4O6S and a molecular weight of 550.64 g/mol. Its IUPAC name is N-cyclohex-2-en-1-yl-2-(3,4-dihydroxyphenyl)-2-(N-[2-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]sulfanylacetyl]anilino)acetamide.
| Compound Name | N-cyclohex-2-en-1-yl-2-(3,4-dihydroxyphenyl)-2-(N-[2-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]sulfanylacetyl]anilino)acetamide |
|---|---|
| PubChem CID | 3189532 |
| Molecular Formula | C28H30N4O6S |
| Molecular Weight | 550.64 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | N-cyclohex-2-en-1-yl-2-(3,4-dihydroxyphenyl)-2-(N-[2-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]sulfanylacetyl]anilino)acetamide |
| SMILES | Cc1cc(NC(=O)CSCC(=O)N(c2ccccc2)C(C(=O)NC2C=CCCC2)c2ccc(O)c(O)c2)no1 |
| InChI | InChI=1S/C28H30N4O6S/c1-18-14-24(31-38-18)30-25(35)16-39-17-26(36)32(21-10-6-3-7-11-21)27(19-12-13-22(33)23(34)15-19)28(37)29-20-8-4-2-5-9-20/h3-4,6-8,10-15,20,27,33-34H,2,5,9,16-17H2,1H3,(H,29,37)(H,30,31,35) |
| InChIKey | VCVGILBSZUNMAA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 145.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.64 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|